CAS 454178-57-5 is the registry number for 3-((3,5-dichlorophenyl)imino)-1-methylindolin-2-one. Offered by: Biosynth. Available pack sizes: 250mg.
3-(3,5-dichlorophenyl)imino-1-methylindol-2-one (CAS 454178-57-5) is a chemical compound with the molecular formula C15H10Cl2N2O and a molecular weight of 305.2 g/mol. IUPAC name: 3-(3,5-dichlorophenyl)imino-1-methylindol-2-one. InChIKey: YWXVLIMRXPAHNA-UHFFFAOYSA-N.
| Molecular formula | C15H10Cl2N2O |
|---|---|
| Molecular weight | 305.2 g/mol |
| IUPAC name | 3-(3,5-dichlorophenyl)imino-1-methylindol-2-one |
| InChIKey | YWXVLIMRXPAHNA-UHFFFAOYSA-N |
| SMILES | CN1C2=CC=CC=C2C(=NC3=CC(=CC(=C3)Cl)Cl)C1=O |
Computed by PubChem (NCBI)