Products 2138424-49-2
CAS 2138424-49-2 is the registry number for 1-(4-Chloro-3-(4-chlorophenyl)phenyl)-2,3-dihydro-1H-pyrazol-3-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-[4-chloro-3-(4-chlorophenyl)phenyl]-1H-pyrazol-5-one (CAS 2138424-49-2) is a chemical compound with the molecular formula C15H10Cl2N2O and a molecular weight of 305.2 g/mol. IUPAC name: 2-[4-chloro-3-(4-chlorophenyl)phenyl]-1H-pyrazol-5-one. InChIKey: RHTXZZQQOLEYRU-UHFFFAOYSA-N.
| Molecular formula | C15H10Cl2N2O |
|---|---|
| Molecular weight | 305.2 g/mol |
| IUPAC name | 2-[4-chloro-3-(4-chlorophenyl)phenyl]-1H-pyrazol-5-one |
| InChIKey | RHTXZZQQOLEYRU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(C=CC(=C2)N3C=CC(=O)N3)Cl)Cl |
Computed by PubChem (NCBI)