Products 1494477-03-0
CAS 1494477-03-0 is the registry number for PSB-1410, 99.22%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 10 mg, 5 mg, 1 mg.
N-(3,4-dichlorophenyl)-1H-indole-5-carboxamide (CAS 1494477-03-0) is a chemical compound with the molecular formula C15H10Cl2N2O and a molecular weight of 305.2 g/mol. IUPAC name: N-(3,4-dichlorophenyl)-1H-indole-5-carboxamide. InChIKey: JKYNYBKCPRHQEA-UHFFFAOYSA-N.
| Molecular formula | C15H10Cl2N2O |
|---|---|
| Molecular weight | 305.2 g/mol |
| IUPAC name | N-(3,4-dichlorophenyl)-1H-indole-5-carboxamide |
| InChIKey | JKYNYBKCPRHQEA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN2)C=C1C(=O)NC3=CC(=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)