Products 1097801-74-5
CAS 1097801-74-5 is the registry number for 2-(2-(2,3-Dichlorophenyl)-1H-1,3-benzodiazol-1-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
2-[2-(2,3-dichlorophenyl)benzimidazol-1-yl]acetic acid (CAS 1097801-74-5) is a chemical compound with the molecular formula C15H10Cl2N2O2 and a molecular weight of 321.2 g/mol. IUPAC name: 2-[2-(2,3-dichlorophenyl)benzimidazol-1-yl]acetic acid. InChIKey: PSKJEMKESYNBRO-UHFFFAOYSA-N.
| Molecular formula | C15H10Cl2N2O2 |
|---|---|
| Molecular weight | 321.2 g/mol |
| IUPAC name | 2-[2-(2,3-dichlorophenyl)benzimidazol-1-yl]acetic acid |
| InChIKey | PSKJEMKESYNBRO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(N2CC(=O)O)C3=C(C(=CC=C3)Cl)Cl |
Computed by PubChem (NCBI)