CAS 1098083-48-7 is the registry number for 4-Bromo-5-methylphthalic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-bromo-5-methylphthalic acid (CAS 1098083-48-7) is a chemical compound with the molecular formula C9H7BrO4 and a molecular weight of 259.05 g/mol. IUPAC name: 4-bromo-5-methylphthalic acid. InChIKey: XCLKIGDTWUDUQM-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO4 |
|---|---|
| Molecular weight | 259.05 g/mol |
| IUPAC name | 4-bromo-5-methylphthalic acid |
| InChIKey | XCLKIGDTWUDUQM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1Br)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)