Products 1098176-51-2
CAS 1098176-51-2 appears in our catalog under these names: Flavokawain 1i, Flavokawain 1i. Offered by: TargetMol, GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 10 mg, 5 mg, 1 mg, 25 mg.
(E)-1-(2-hydroxy-4,6-dimethoxyphenyl)-3-naphthalen-1-ylprop-2-en-1-one (CAS 1098176-51-2) is a chemical compound with the molecular formula C21H18O4 and a molecular weight of 334.4 g/mol. IUPAC name: (E)-1-(2-hydroxy-4,6-dimethoxyphenyl)-3-naphthalen-1-ylprop-2-en-1-one. InChIKey: VRBQMXBABFUWOQ-ZHACJKMWSA-N.
| Molecular formula | C21H18O4 |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | (E)-1-(2-hydroxy-4,6-dimethoxyphenyl)-3-naphthalen-1-ylprop-2-en-1-one |
| InChIKey | VRBQMXBABFUWOQ-ZHACJKMWSA-N |
| SMILES | COC1=CC(=C(C(=C1)OC)C(=O)/C=C/C2=CC=CC3=CC=CC=C32)O |
Computed by PubChem (NCBI)