Products 852536-39-1
CAS 852536-39-1 appears in our catalog under these names: 4,4'-(7-Hydroxychroman-3,4-diyl)diphenol, ME-143, 99.01%. Offered by: Biosynth, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100 mg, 10 mg, 5 mg.
3,4-bis(4-hydroxyphenyl)-3,4-dihydro-2H-chromen-7-ol (CAS 852536-39-1) is a chemical compound with the molecular formula C21H18O4 and a molecular weight of 334.4 g/mol. IUPAC name: 3,4-bis(4-hydroxyphenyl)-3,4-dihydro-2H-chromen-7-ol. InChIKey: VXHSDGZMRLGSEJ-UHFFFAOYSA-N.
| Molecular formula | C21H18O4 |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | 3,4-bis(4-hydroxyphenyl)-3,4-dihydro-2H-chromen-7-ol |
| InChIKey | VXHSDGZMRLGSEJ-UHFFFAOYSA-N |
| SMILES | C1C(C(C2=C(O1)C=C(C=C2)O)C3=CC=C(C=C3)O)C4=CC=C(C=C4)O |
Computed by PubChem (NCBI)