CAS 67127-91-7 appears in our catalog under these names: 2,5-Bis(benzyloxy)benzoic acid, 98%, 98%, 2,5-Bis-benzyloxy-benzoic acid, 96%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g.
2,5-bis(phenylmethoxy)benzoic acid (CAS 67127-91-7) is a chemical compound with the molecular formula C21H18O4 and a molecular weight of 334.4 g/mol. IUPAC name: 2,5-bis(phenylmethoxy)benzoic acid. InChIKey: JCXIICUMJCMYAV-UHFFFAOYSA-N.
| Molecular formula | C21H18O4 |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | 2,5-bis(phenylmethoxy)benzoic acid |
| InChIKey | JCXIICUMJCMYAV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=C(C=C2)OCC3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)