Products 28917-43-3
CAS 28917-43-3 appears in our catalog under these names: Terbutaline Impurity 48, 3，5–Dibenzyloxy Benzoic Acid, 3,5-Dibenzyloxybenzoic Acid, 3,5-Dibenzyloxybenzoic Acid, >97.0%(HPLC)(T), 3,5-Bis(benzyloxy)benzoic acid 96%. Offered by: Chemat Brand, GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: on request, 25g, 5g, 10g, 50g, 100g, 500g, 1kg.
3,5-bis(phenylmethoxy)benzoic acid (CAS 28917-43-3) is a chemical compound with the molecular formula C21H18O4 and a molecular weight of 334.4 g/mol. IUPAC name: 3,5-bis(phenylmethoxy)benzoic acid. InChIKey: DHQIBPUGSWVDOH-UHFFFAOYSA-N.
| Molecular formula | C21H18O4 |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | 3,5-bis(phenylmethoxy)benzoic acid |
| InChIKey | DHQIBPUGSWVDOH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=CC(=C2)C(=O)O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)