Products 189390-61-2

CAS 189390-61-2 is the registry number for 2-(Methacryloyloxy)ethyl anthracene-9-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(2-methylprop-2-enoyloxy)ethyl anthracene-9-carboxylate (CAS 189390-61-2) is a chemical compound with the molecular formula C21H18O4 and a molecular weight of 334.4 g/mol. IUPAC name: 2-(2-methylprop-2-enoyloxy)ethyl anthracene-9-carboxylate. InChIKey: XPAKVTKJKMTQPT-UHFFFAOYSA-N.

Identity
Molecular formulaC21H18O4
Molecular weight334.4 g/mol
IUPAC name2-(2-methylprop-2-enoyloxy)ethyl anthracene-9-carboxylate
InChIKeyXPAKVTKJKMTQPT-UHFFFAOYSA-N
SMILESCC(=C)C(=O)OCCOC(=O)C1=C2C=CC=CC2=CC3=CC=CC=C31

Computed by PubChem (NCBI)