Products 153777-97-0
CAS 153777-97-0 is the registry number for 2,2-Bis(4-hydroxyphenyl)-1-(4-methoxyphenyl)ethanone. Offered by: TRC. Available pack sizes: 100mg.
2,2-bis(4-hydroxyphenyl)-1-(4-methoxyphenyl)ethanone (CAS 153777-97-0) is a chemical compound with the molecular formula C21H18O4 and a molecular weight of 334.4 g/mol. IUPAC name: 2,2-bis(4-hydroxyphenyl)-1-(4-methoxyphenyl)ethanone. InChIKey: IWKCFWXAHMYQOE-UHFFFAOYSA-N.
| Molecular formula | C21H18O4 |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | 2,2-bis(4-hydroxyphenyl)-1-(4-methoxyphenyl)ethanone |
| InChIKey | IWKCFWXAHMYQOE-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)C(C2=CC=C(C=C2)O)C3=CC=C(C=C3)O |
Computed by PubChem (NCBI)