CAS 1570-05-4 appears in our catalog under these names: 3,4-Bis(phenylmethoxy)-benzoic Acid, 3,4–Bis(benzyloxy)benzoic acid, 3,4-Bis(benzyloxy)benzoic acid, 95%, 95%, 3,4-Bis(benzyloxy)benzoic acid, 95%, 3,4-Bis(benzyloxy)benzoic acid, 97%. Offered by: TRC, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 2,5g, 25g, 1g, 5g, 250mg, 10g.
3,4-bis(phenylmethoxy)benzoic acid (CAS 1570-05-4) is a chemical compound with the molecular formula C21H18O4 and a molecular weight of 334.4 g/mol. IUPAC name: 3,4-bis(phenylmethoxy)benzoic acid. InChIKey: BYOKJLCIKSFPDU-UHFFFAOYSA-N.
| Molecular formula | C21H18O4 |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | 3,4-bis(phenylmethoxy)benzoic acid |
| InChIKey | BYOKJLCIKSFPDU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2)C(=O)O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)