CAS 1098881-13-0 appears in our catalog under these names: (1R,3S)-3-(Methoxycarbonyl)cyclopentanecarboxylic acid, 97%, (1R,3S)-3-(Methoxycarbonyl)cyclopentane-1-carboxylic acid, (1R,3S)-3-(Methoxycarbonyl)cyclopentanecarboxylic acid, 97%, 97%, (1R,3S)-3-(Methoxycarbonyl)cyclopentane-1-carboxylic acid, 97%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 50mg, 0,5g, 100mg, 250mg, 1g, 500mg.
Cis-(1R,3S)-3-methoxycarbonylcyclopentane-1-carboxylic acid (CAS 1098881-13-0) is a chemical compound with the molecular formula C8H12O4 and a molecular weight of 172.18 g/mol. IUPAC name: cis-(1R,3S)-3-methoxycarbonylcyclopentane-1-carboxylic acid. InChIKey: FVUHGTQDOMGZOT-RITPCOANSA-N.
| Molecular formula | C8H12O4 |
|---|---|
| Molecular weight | 172.18 g/mol |
| IUPAC name | cis-(1R,3S)-3-methoxycarbonylcyclopentane-1-carboxylic acid |
| InChIKey | FVUHGTQDOMGZOT-RITPCOANSA-N |
| SMILES | COC(=O)[C@H]1CC[C@H](C1)C(=O)O |
Computed by PubChem (NCBI)