Products 111139-10-7

CAS 111139-10-7 is the registry number for trans-3-(Methoxycarbonyl)cyclopentanecarboxylic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.

Structural formula: {0} (CAS {1})

Trans-(1R,3R)-3-methoxycarbonylcyclopentane-1-carboxylic acid (CAS 111139-10-7) is a chemical compound with the molecular formula C8H12O4 and a molecular weight of 172.18 g/mol. IUPAC name: trans-(1R,3R)-3-methoxycarbonylcyclopentane-1-carboxylic acid. InChIKey: FVUHGTQDOMGZOT-PHDIDXHHSA-N.

Identity
Molecular formulaC8H12O4
Molecular weight172.18 g/mol
IUPAC nametrans-(1R,3R)-3-methoxycarbonylcyclopentane-1-carboxylic acid
InChIKeyFVUHGTQDOMGZOT-PHDIDXHHSA-N
SMILESCOC(=O)[C@@H]1CC[C@H](C1)C(=O)O

Computed by PubChem (NCBI)