Products 109910-66-9
CAS 109910-66-9 is the registry number for DL-threo-beta-(3,4-Methylenedioxyphenyl)serine Acetate Salt. Offered by: TRC. Available pack sizes: 2,5g, 250mg.
Acetic acid;(2R,3S)-2-amino-3-(1,3-benzodioxol-5-yl)-3-hydroxypropanoic acid (CAS 109910-66-9) is a chemical compound with the molecular formula C12H15NO7 and a molecular weight of 285.25 g/mol. IUPAC name: acetic acid;(2R,3S)-2-amino-3-(1,3-benzodioxol-5-yl)-3-hydroxypropanoic acid. InChIKey: MLMBILXCWROGFT-RJUBDTSPSA-N.
| Molecular formula | C12H15NO7 |
|---|---|
| Molecular weight | 285.25 g/mol |
| IUPAC name | acetic acid;(2R,3S)-2-amino-3-(1,3-benzodioxol-5-yl)-3-hydroxypropanoic acid |
| InChIKey | MLMBILXCWROGFT-RJUBDTSPSA-N |
| SMILES | CC(=O)O.C1OC2=C(O1)C=C(C=C2)[C@@H]([C@H](C(=O)O)N)O |
Computed by PubChem (NCBI)