CAS 122011-38-5 is the registry number for M-Peg3-4-nitrophenyl carbonate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-(2-methoxyethoxy)ethyl (4-nitrophenyl) carbonate (CAS 122011-38-5) is a chemical compound with the molecular formula C12H15NO7 and a molecular weight of 285.25 g/mol. IUPAC name: 2-(2-methoxyethoxy)ethyl (4-nitrophenyl) carbonate. InChIKey: PEBJXUZWQCMUAO-UHFFFAOYSA-N.
| Molecular formula | C12H15NO7 |
|---|---|
| Molecular weight | 285.25 g/mol |
| IUPAC name | 2-(2-methoxyethoxy)ethyl (4-nitrophenyl) carbonate |
| InChIKey | PEBJXUZWQCMUAO-UHFFFAOYSA-N |
| SMILES | COCCOCCOC(=O)OC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)