Products 1329610-57-2
CAS 1329610-57-2 is the registry number for DL-threo-beta-(3,4-Methylenedioxyphenyl)serine-13C2,15N Acetate Salt. Offered by: TRC. Available pack sizes: 50mg, 5mg.
Acetic acid;(2R,3S)-2-(15N)azanyl-3-(1,3-benzodioxol-5-yl)-3-hydroxy(1,2-13C2)propanoic acid (CAS 1329610-57-2) is a chemical compound with the molecular formula C12H15NO7 and a molecular weight of 288.23 g/mol. IUPAC name: acetic acid;(2R,3S)-2-(15N)azanyl-3-(1,3-benzodioxol-5-yl)-3-hydroxy(1,2-13C2)propanoic acid. InChIKey: MLMBILXCWROGFT-LNCIXIQQSA-N.
| Molecular formula | C12H15NO7 |
|---|---|
| Molecular weight | 288.23 g/mol |
| IUPAC name | acetic acid;(2R,3S)-2-(15N)azanyl-3-(1,3-benzodioxol-5-yl)-3-hydroxy(1,2-13C2)propanoic acid |
| InChIKey | MLMBILXCWROGFT-LNCIXIQQSA-N |
| SMILES | CC(=O)O.C1OC2=C(O1)C=C(C=C2)[C@@H]([13C@H]([13C](=O)O)[15NH2])O |
Computed by PubChem (NCBI)