CAS 150025-35-7 appears in our catalog under these names: 2-Nitrophenyl beta-l-fucopyranoside, 95%, 2-Nitrophenyl b-L-fucopyranoside. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 10mg, 5mg, 25mg, 50mg, 100mg.
(2S,3S,4R,5S,6S)-2-methyl-6-(2-nitrophenoxy)oxane-3,4,5-triol (CAS 150025-35-7) is a chemical compound with the molecular formula C12H15NO7 and a molecular weight of 285.25 g/mol. IUPAC name: (2S,3S,4R,5S,6S)-2-methyl-6-(2-nitrophenoxy)oxane-3,4,5-triol. InChIKey: SWRPIVXPHLYETN-SQKFTNEHSA-N.
| Molecular formula | C12H15NO7 |
|---|---|
| Molecular weight | 285.25 g/mol |
| IUPAC name | (2S,3S,4R,5S,6S)-2-methyl-6-(2-nitrophenoxy)oxane-3,4,5-triol |
| InChIKey | SWRPIVXPHLYETN-SQKFTNEHSA-N |
| SMILES | C[C@H]1[C@H]([C@H]([C@@H]([C@@H](O1)OC2=CC=CC=C2[N+](=O)[O-])O)O)O |
Computed by PubChem (NCBI)