Products 355017-64-0
CAS 355017-64-0 appears in our catalog under these names: 4-(4-(Hydroxymethyl)-2-methoxy-5-nitrophenoxy)butanoic acid, 4-(4-(Hydroxymethyl)-2-methoxy-5-nitrophenoxy)butanoic acid, 98%, 98%, 4-[4-(hydroxymethyl)-2-methoxy-5-nitrophenoxy]butanoic acid, >=98%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 0,025g, 0,05g, 0,1g, 0,5g, 0,25g, 25mg, 100mg.
4-[4-(hydroxymethyl)-2-methoxy-5-nitrophenoxy]butanoic acid (CAS 355017-64-0) is a chemical compound with the molecular formula C12H15NO7 and a molecular weight of 285.25 g/mol. IUPAC name: 4-[4-(hydroxymethyl)-2-methoxy-5-nitrophenoxy]butanoic acid. InChIKey: MYBBGZZXDFIZGU-UHFFFAOYSA-N.
| Molecular formula | C12H15NO7 |
|---|---|
| Molecular weight | 285.25 g/mol |
| IUPAC name | 4-[4-(hydroxymethyl)-2-methoxy-5-nitrophenoxy]butanoic acid |
| InChIKey | MYBBGZZXDFIZGU-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)CO)[N+](=O)[O-])OCCCC(=O)O |
Computed by PubChem (NCBI)