CAS 15959-03-2 appears in our catalog under these names: 2-Aminophenyl Beta-D-Glucuronide, 2-Aminophenyl β-D-glucuronide, 2-Aminophenyl-beta-d-glucuronic acid, 95%. Offered by: TRC, MedChemExpress, Combi-blocks. Available pack sizes: 50mg, 25 mg, 50 mg, 100mg, 250mg.
(2S,3S,4S,5R,6S)-6-(2-aminophenoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid (CAS 15959-03-2) is a chemical compound with the molecular formula C12H15NO7 and a molecular weight of 285.25 g/mol. IUPAC name: (2S,3S,4S,5R,6S)-6-(2-aminophenoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid. InChIKey: ZVFVTBSWJWONEI-GOVZDWNOSA-N.
| Molecular formula | C12H15NO7 |
|---|---|
| Molecular weight | 285.25 g/mol |
| IUPAC name | (2S,3S,4S,5R,6S)-6-(2-aminophenoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid |
| InChIKey | ZVFVTBSWJWONEI-GOVZDWNOSA-N |
| SMILES | C1=CC=C(C(=C1)N)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)C(=O)O)O)O)O |
Computed by PubChem (NCBI)