CAS 21080-66-0 appears in our catalog under these names: 4-Aminophenyl beta-d-glucuronide, 95%, (2S,3S,4S,5R,6S)-6-(4-Aminophenoxy)-3,4,5-trihydroxytetrahydro-2H-pyran-2-carboxylic acid, 97%, 4-Aminophenyl β-D-glucuronide, 4-Aminophenyl β-D-glucuronide sodium, 4-Aminophenyl β-D-glucuronide, 95%, 95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, MedChemExpress. Available pack sizes: 250mg, 100mg, 50mg, 25mg, 500mg, 50 mg, 10 mg, 25 mg.
(2S,3S,4S,5R,6S)-6-(4-aminophenoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid (CAS 21080-66-0) is a chemical compound with the molecular formula C12H15NO7 and a molecular weight of 285.25 g/mol. IUPAC name: (2S,3S,4S,5R,6S)-6-(4-aminophenoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid. InChIKey: ZARKEMJKQOXOSQ-GOVZDWNOSA-N.
| Molecular formula | C12H15NO7 |
|---|---|
| Molecular weight | 285.25 g/mol |
| IUPAC name | (2S,3S,4S,5R,6S)-6-(4-aminophenoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid |
| InChIKey | ZARKEMJKQOXOSQ-GOVZDWNOSA-N |
| SMILES | C1=CC(=CC=C1N)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)C(=O)O)O)O)O |
Computed by PubChem (NCBI)