CAS 18918-31-5 appears in our catalog under these names: 4-Nitrophenyl-alpha-l-rhamnoside, 98%, 4-Nitrophenyl alpha-L-Rhamnopyranoside, 4–Nitrophenyl α–L–rhamnopyranoside, 4-Nitrophenyl α-L-rhamnopyranoside, 4-Nitrophenyl α-L-rhamnopyranoside 98%. Offered by: Combi-blocks, TRC, GLPBio, Biosynth, Ambeed. Available pack sizes: 1g, 250mg, 100mg, 500mg, 10mg, 25mg, 50mg, 1000mg.
(2S,3R,4R,5R,6S)-2-methyl-6-(4-nitrophenoxy)oxane-3,4,5-triol (CAS 18918-31-5) is a chemical compound with the molecular formula C12H15NO7 and a molecular weight of 285.25 g/mol. IUPAC name: (2S,3R,4R,5R,6S)-2-methyl-6-(4-nitrophenoxy)oxane-3,4,5-triol. InChIKey: YILIDCGSXCGACV-UOAXWKJLSA-N.
| Molecular formula | C12H15NO7 |
|---|---|
| Molecular weight | 285.25 g/mol |
| IUPAC name | (2S,3R,4R,5R,6S)-2-methyl-6-(4-nitrophenoxy)oxane-3,4,5-triol |
| InChIKey | YILIDCGSXCGACV-UOAXWKJLSA-N |
| SMILES | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OC2=CC=C(C=C2)[N+](=O)[O-])O)O)O |
Computed by PubChem (NCBI)