CAS 109963-61-3 appears in our catalog under these names: 4-(4-Methoxycarbonylphenyl)benzoic acid, 96%, 4'-(Methoxycarbonyl)-(1,1'-biphenyl)-4-carboxylic acid, 4-(4-Methoxycarbonylphenyl)benzoic acid, 96%, 96%, 4'-(Methoxycarbonyl)[1,1'-biphenyl]-4-carboxylic acid, 95%, 4-[4-(methoxycarbonyl)phenyl]benzoic acid, 96%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 250mg, 0,5g.
4-(4-methoxycarbonylphenyl)benzoic acid (CAS 109963-61-3) is a chemical compound with the molecular formula C15H12O4 and a molecular weight of 256.25 g/mol. IUPAC name: 4-(4-methoxycarbonylphenyl)benzoic acid. InChIKey: LIKHRLCRYVOFEK-UHFFFAOYSA-N.
| Molecular formula | C15H12O4 |
|---|---|
| Molecular weight | 256.25 g/mol |
| IUPAC name | 4-(4-methoxycarbonylphenyl)benzoic acid |
| InChIKey | LIKHRLCRYVOFEK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)