CAS 1105193-94-9 is the registry number for 5-(2-(methylsulfonyl)phenyl)-1,3,4-oxadiazol-2-amine, 95%. Offered by: AmBeed. Available pack sizes: 10g, 5g.
5-(2-methylsulfonylphenyl)-1,3,4-oxadiazol-2-amine (CAS 1105193-94-9) is a chemical compound with the molecular formula C9H9N3O3S and a molecular weight of 239.25 g/mol. IUPAC name: 5-(2-methylsulfonylphenyl)-1,3,4-oxadiazol-2-amine. InChIKey: OIGWQQSGEQSQPU-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O3S |
|---|---|
| Molecular weight | 239.25 g/mol |
| IUPAC name | 5-(2-methylsulfonylphenyl)-1,3,4-oxadiazol-2-amine |
| InChIKey | OIGWQQSGEQSQPU-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=CC=C1C2=NN=C(O2)N |
Computed by PubChem (NCBI)