CAS 2089315-35-3 appears in our catalog under these names: 3-Amino-4,6-dimethyl-7-oxo-6,7-dihydrothieno[2,3-d]pyridazine-2-carboxylic acid, 95%, 3-Amino-4,6-dimethyl-7-oxo-6,7-dihydrothieno(2,3-d)pyridazine-2-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 1g.
3-amino-4,6-dimethyl-7-oxothieno[2,3-d]pyridazine-2-carboxylic acid (CAS 2089315-35-3) is a chemical compound with the molecular formula C9H9N3O3S and a molecular weight of 239.25 g/mol. IUPAC name: 3-amino-4,6-dimethyl-7-oxothieno[2,3-d]pyridazine-2-carboxylic acid. InChIKey: TZVRDGLMCMECBU-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O3S |
|---|---|
| Molecular weight | 239.25 g/mol |
| IUPAC name | 3-amino-4,6-dimethyl-7-oxothieno[2,3-d]pyridazine-2-carboxylic acid |
| InChIKey | TZVRDGLMCMECBU-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=O)C2=C1C(=C(S2)C(=O)O)N)C |
Computed by PubChem (NCBI)