CAS 874784-12-0 is the registry number for 4-Methyl-5-phenyl-4H-1,2,4-triazole-3-sulfonic acid, 98%. Offered by: Fluorochem. Available pack sizes: 250mg, 1g.
4-methyl-5-phenyl-1,2,4-triazole-3-sulfonic acid (CAS 874784-12-0) is a chemical compound with the molecular formula C9H9N3O3S and a molecular weight of 239.25 g/mol. IUPAC name: 4-methyl-5-phenyl-1,2,4-triazole-3-sulfonic acid. InChIKey: JLHXPIOHZDOODW-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O3S |
|---|---|
| Molecular weight | 239.25 g/mol |
| IUPAC name | 4-methyl-5-phenyl-1,2,4-triazole-3-sulfonic acid |
| InChIKey | JLHXPIOHZDOODW-UHFFFAOYSA-N |
| SMILES | CN1C(=NN=C1S(=O)(=O)O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)