CAS 897773-56-7 is the registry number for Methyl 2-ethyl-7-oxo-7H-[1,3,4]thiadiazolo[3,2-a]pyrimidine-5-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-ethyl-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidine-5-carboxylate (CAS 897773-56-7) is a chemical compound with the molecular formula C9H9N3O3S and a molecular weight of 239.25 g/mol. IUPAC name: methyl 2-ethyl-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidine-5-carboxylate. InChIKey: XKQCCOJBBJFHBK-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O3S |
|---|---|
| Molecular weight | 239.25 g/mol |
| IUPAC name | methyl 2-ethyl-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidine-5-carboxylate |
| InChIKey | XKQCCOJBBJFHBK-UHFFFAOYSA-N |
| SMILES | CCC1=NN2C(=CC(=O)N=C2S1)C(=O)OC |
Computed by PubChem (NCBI)