CAS 2287344-02-7 is the registry number for 3-(4-Hydroxy-1H-benzo[d][1,2,3]triazol-1-yl)thietane 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(1,1-dioxothietan-3-yl)benzotriazol-4-ol (CAS 2287344-02-7) is a chemical compound with the molecular formula C9H9N3O3S and a molecular weight of 239.25 g/mol. IUPAC name: 1-(1,1-dioxothietan-3-yl)benzotriazol-4-ol. InChIKey: BDXQZJSBWGDWJH-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O3S |
|---|---|
| Molecular weight | 239.25 g/mol |
| IUPAC name | 1-(1,1-dioxothietan-3-yl)benzotriazol-4-ol |
| InChIKey | BDXQZJSBWGDWJH-UHFFFAOYSA-N |
| SMILES | C1C(CS1(=O)=O)N2C3=C(C(=CC=C3)O)N=N2 |
Computed by PubChem (NCBI)