Products 112273-79-7

CAS 112273-79-7 is the registry number for 2-(2-Carbamothioylhydrazine-1-carbonyl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[(carbamothioylamino)carbamoyl]benzoic acid (CAS 112273-79-7) is a chemical compound with the molecular formula C9H9N3O3S and a molecular weight of 239.25 g/mol. IUPAC name: 2-[(carbamothioylamino)carbamoyl]benzoic acid. InChIKey: KPSPJRDTOGNICU-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9N3O3S
Molecular weight239.25 g/mol
IUPAC name2-[(carbamothioylamino)carbamoyl]benzoic acid
InChIKeyKPSPJRDTOGNICU-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C(=O)NNC(=S)N)C(=O)O

Computed by PubChem (NCBI)