CAS 1858267-88-5 appears in our catalog under these names: 4-(5-(Methylsulfonyl)-1,3,4-oxadiazol-2-yl)aniline, 95%, 4–(5–(Methylsulfonyl)–1,3,4–oxadiazol–2–yl)aniline, 4-(5-(Methylsulfonyl)-1,3,4-oxadiazol-2-yl)aniline, 97%, 97%, 4-(5-(Methylsulfonyl)-1,3,4-oxadiazol-2-yl)aniline, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 50mg.
4-(5-methylsulfonyl-1,3,4-oxadiazol-2-yl)aniline (CAS 1858267-88-5) is a chemical compound with the molecular formula C9H9N3O3S and a molecular weight of 239.25 g/mol. IUPAC name: 4-(5-methylsulfonyl-1,3,4-oxadiazol-2-yl)aniline. InChIKey: ULORBWQDLLOPLY-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O3S |
|---|---|
| Molecular weight | 239.25 g/mol |
| IUPAC name | 4-(5-methylsulfonyl-1,3,4-oxadiazol-2-yl)aniline |
| InChIKey | ULORBWQDLLOPLY-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=NN=C(O1)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)