CAS 2803930-60-9 is the registry number for 2-Methyl-4-(methylsulfonyl)pyrido[2,3-d]pyrimidin-7(8H)-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-methyl-4-methylsulfonyl-8H-pyrido[2,3-d]pyrimidin-7-one (CAS 2803930-60-9) is a chemical compound with the molecular formula C9H9N3O3S and a molecular weight of 239.25 g/mol. IUPAC name: 2-methyl-4-methylsulfonyl-8H-pyrido[2,3-d]pyrimidin-7-one. InChIKey: JDYSFCLKLRYHGE-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O3S |
|---|---|
| Molecular weight | 239.25 g/mol |
| IUPAC name | 2-methyl-4-methylsulfonyl-8H-pyrido[2,3-d]pyrimidin-7-one |
| InChIKey | JDYSFCLKLRYHGE-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=CC(=O)N2)C(=N1)S(=O)(=O)C |
Computed by PubChem (NCBI)