CAS 1105194-38-4 appears in our catalog under these names: 6-(5-Methylthiophen-2-yl)-2,3-dihydropyridazin-3-one, 95%, 6-(5-Methylthiophen-2-yl)pyridazin-3(2h)-one, 98%, 6-(5-Methylthiophen-2-yl)-2,3-dihydropyridazin-3-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
3-(5-methylthiophen-2-yl)-1H-pyridazin-6-one (CAS 1105194-38-4) is a chemical compound with the molecular formula C9H8N2OS and a molecular weight of 192.24 g/mol. IUPAC name: 3-(5-methylthiophen-2-yl)-1H-pyridazin-6-one. InChIKey: JEHQIYNKISJEHE-UHFFFAOYSA-N.
| Molecular formula | C9H8N2OS |
|---|---|
| Molecular weight | 192.24 g/mol |
| IUPAC name | 3-(5-methylthiophen-2-yl)-1H-pyridazin-6-one |
| InChIKey | JEHQIYNKISJEHE-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(S1)C2=NNC(=O)C=C2 |
Computed by PubChem (NCBI)