CAS 60135-72-0 appears in our catalog under these names: 2-(2-Amino-thiazol-4-yl)-phenol, 95%, 4-(2-Hydroxyphenyl)-1,3-thiazol-2-amine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 5g, 10000mg.
2-(2-amino-1,3-thiazol-4-yl)phenol (CAS 60135-72-0) is a chemical compound with the molecular formula C9H8N2OS and a molecular weight of 192.24 g/mol. IUPAC name: 2-(2-amino-1,3-thiazol-4-yl)phenol. InChIKey: QCWXFHZAXVHMHQ-UHFFFAOYSA-N.
| Molecular formula | C9H8N2OS |
|---|---|
| Molecular weight | 192.24 g/mol |
| IUPAC name | 2-(2-amino-1,3-thiazol-4-yl)phenol |
| InChIKey | QCWXFHZAXVHMHQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CSC(=N2)N)O |
Computed by PubChem (NCBI)