CAS 23288-90-6 appears in our catalog under these names: 5-Benzyl-[1,3,4]oxadiazole-2-thiol, 95%, 5-Benzyl-1,3,4-oxadiazole-2-thiol, 97%, 5-Benzyl-1,3,4-oxadiazole-2-thiol. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 10g, 1g, 2,5g.
5-benzyl-3H-1,3,4-oxadiazole-2-thione (CAS 23288-90-6) is a chemical compound with the molecular formula C9H8N2OS and a molecular weight of 192.24 g/mol. IUPAC name: 5-benzyl-3H-1,3,4-oxadiazole-2-thione. InChIKey: ARGIBMBTIISQNH-UHFFFAOYSA-N.
| Molecular formula | C9H8N2OS |
|---|---|
| Molecular weight | 192.24 g/mol |
| IUPAC name | 5-benzyl-3H-1,3,4-oxadiazole-2-thione |
| InChIKey | ARGIBMBTIISQNH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=NNC(=S)O2 |
Computed by PubChem (NCBI)