CAS 110661-59-1 appears in our catalog under these names: (4-Methoxyphenyl)methanesulfonyl chloride, 95%, (4-Methoxyphenyl)methanesulfonyl Chloride. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
(4-methoxyphenyl)methanesulfonyl chloride (CAS 110661-59-1) is a chemical compound with the molecular formula C8H9ClO3S and a molecular weight of 220.67 g/mol. IUPAC name: (4-methoxyphenyl)methanesulfonyl chloride. InChIKey: VEFXSKSTBDKZFF-UHFFFAOYSA-N.
| Molecular formula | C8H9ClO3S |
|---|---|
| Molecular weight | 220.67 g/mol |
| IUPAC name | (4-methoxyphenyl)methanesulfonyl chloride |
| InChIKey | VEFXSKSTBDKZFF-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CS(=O)(=O)Cl |
Computed by PubChem (NCBI)