Products 88040-86-2

CAS 88040-86-2 appears in our catalog under these names: 2–methoxy–5–methylbenzenesulfonyl chloride, 2-Methoxy-5-methylbenzenesulfonyl chloride, 98%, 6-Methoxy-m-toluenesulfonyl chloride, 95%. Offered by: GLPBio, Fluorochem, Combi-blocks. Available pack sizes: 1g, 250mg, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

2-methoxy-5-methylbenzenesulfonyl chloride (CAS 88040-86-2) is a chemical compound with the molecular formula C8H9ClO3S and a molecular weight of 220.67 g/mol. IUPAC name: 2-methoxy-5-methylbenzenesulfonyl chloride. InChIKey: BJYNYQGJTZULJI-UHFFFAOYSA-N.

Identity
Molecular formulaC8H9ClO3S
Molecular weight220.67 g/mol
IUPAC name2-methoxy-5-methylbenzenesulfonyl chloride
InChIKeyBJYNYQGJTZULJI-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1)OC)S(=O)(=O)Cl

Computed by PubChem (NCBI)