Products 861560-21-6

CAS 861560-21-6 is the registry number for 3-Methoxy-5-methylbenzenesulfonyl chloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

3-methoxy-5-methylbenzenesulfonyl chloride (CAS 861560-21-6) is a chemical compound with the molecular formula C8H9ClO3S and a molecular weight of 220.67 g/mol. IUPAC name: 3-methoxy-5-methylbenzenesulfonyl chloride. InChIKey: ZUWALFVVYFEZSI-UHFFFAOYSA-N.

Identity
Molecular formulaC8H9ClO3S
Molecular weight220.67 g/mol
IUPAC name3-methoxy-5-methylbenzenesulfonyl chloride
InChIKeyZUWALFVVYFEZSI-UHFFFAOYSA-N
SMILESCC1=CC(=CC(=C1)S(=O)(=O)Cl)OC

Computed by PubChem (NCBI)