CAS 1132-17-8 appears in our catalog under these names: 4-Ethoxy-benzenesulfonyl chloride, 97%, 4-Ethoxy-benzenesulfonyl chloride, 95%, 4-Ethoxybenzene-1-sulfonyl chloride, 98%. Offered by: Combi-blocks, Fluorochem, Ambeed. Available pack sizes: 100g, 5g, 25g, 1g, 10g, 250mg.
4-ethoxybenzenesulfonyl chloride (CAS 1132-17-8) is a chemical compound with the molecular formula C8H9ClO3S and a molecular weight of 220.67 g/mol. IUPAC name: 4-ethoxybenzenesulfonyl chloride. InChIKey: XIWSSFMVSKKXRJ-UHFFFAOYSA-N.
| Molecular formula | C8H9ClO3S |
|---|---|
| Molecular weight | 220.67 g/mol |
| IUPAC name | 4-ethoxybenzenesulfonyl chloride |
| InChIKey | XIWSSFMVSKKXRJ-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)