Products 16670-48-7
CAS 16670-48-7 appears in our catalog under these names: Benzenesulfonic acid 2-chloroethyl ester, 95%, Ethyl 2-chlorobenzenesulfonate, 98%, 2–Chloroethyl Benzenesulfonate, 2-Chloroethyl Benzenesulfonate, >98.0%(GC), Benzenesulfonic Acid 2-Chloroethyl Ester, 99%, 99%. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 10g, 1g, 5g, 25g.
2-chloroethyl benzenesulfonate (CAS 16670-48-7) is a chemical compound with the molecular formula C8H9ClO3S and a molecular weight of 220.67 g/mol. IUPAC name: 2-chloroethyl benzenesulfonate. InChIKey: CIIGWOXXOUVEAD-UHFFFAOYSA-N.
| Molecular formula | C8H9ClO3S |
|---|---|
| Molecular weight | 220.67 g/mol |
| IUPAC name | 2-chloroethyl benzenesulfonate |
| InChIKey | CIIGWOXXOUVEAD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)OCCCl |
Computed by PubChem (NCBI)