CAS 216394-11-5 appears in our catalog under these names: 2-Methoxy-4-methylbenzene-1-sulfonyl chloride, 95-<97%, 2-Methoxy-4-methylbenzene-1-sulfonyl chloride, ≥97-<99%, 2-Methoxy-4-methylbenzene-1-sulfonyl chloride, 95%. Offered by: Hoffman Fine Chemicals, AmBeed. Available pack sizes: 5g, 10g, 25g, 50g, 100g.
2-methoxy-4-methylbenzenesulfonyl chloride (CAS 216394-11-5) is a chemical compound with the molecular formula C8H9ClO3S and a molecular weight of 220.67 g/mol. IUPAC name: 2-methoxy-4-methylbenzenesulfonyl chloride. InChIKey: BEDNMYGUVYQPTP-UHFFFAOYSA-N.
| Molecular formula | C8H9ClO3S |
|---|---|
| Molecular weight | 220.67 g/mol |
| IUPAC name | 2-methoxy-4-methylbenzenesulfonyl chloride |
| InChIKey | BEDNMYGUVYQPTP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)S(=O)(=O)Cl)OC |
Computed by PubChem (NCBI)