CAS 1820707-89-8 is the registry number for 4-Chloro-1-methanesulfonyl-2-methoxybenzene, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4-chloro-2-methoxy-1-methylsulfonylbenzene (CAS 1820707-89-8) is a chemical compound with the molecular formula C8H9ClO3S and a molecular weight of 220.67 g/mol. IUPAC name: 4-chloro-2-methoxy-1-methylsulfonylbenzene. InChIKey: BJCUUCOZRQYWHI-UHFFFAOYSA-N.
| Molecular formula | C8H9ClO3S |
|---|---|
| Molecular weight | 220.67 g/mol |
| IUPAC name | 4-chloro-2-methoxy-1-methylsulfonylbenzene |
| InChIKey | BJCUUCOZRQYWHI-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)Cl)S(=O)(=O)C |
Computed by PubChem (NCBI)