Products 152708-83-3

CAS 152708-83-3 appears in our catalog under these names: 3–Methoxy–4–methylbenzenesulfonyl chloride, 3-Methoxy-4-methylbenzene-1-sulfonyl chloride, 3-Methoxy-4-methylbenzene-1-sulfonyl chloride, 95%. Offered by: GLPBio, Biosynth, Combi-blocks. Available pack sizes: 100mg, 50mg, 0,5g, 250mg.

Structural formula: {0} (CAS {1})

3-methoxy-4-methylbenzenesulfonyl chloride (CAS 152708-83-3) is a chemical compound with the molecular formula C8H9ClO3S and a molecular weight of 220.67 g/mol. IUPAC name: 3-methoxy-4-methylbenzenesulfonyl chloride. InChIKey: WANDMOOEYBNNME-UHFFFAOYSA-N.

Identity
Molecular formulaC8H9ClO3S
Molecular weight220.67 g/mol
IUPAC name3-methoxy-4-methylbenzenesulfonyl chloride
InChIKeyWANDMOOEYBNNME-UHFFFAOYSA-N
SMILESCC1=C(C=C(C=C1)S(=O)(=O)Cl)OC

Computed by PubChem (NCBI)