CAS 84910-98-5 appears in our catalog under these names: 4-Methoxy-3-methylbenzenesulfonyl chloride, 95%, 4-Methoxy-3-methylbenzene-1-sulfonyl chloride, 97%, 4-Methoxy-3-methylbenzenesulfonyl chloride, 97%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 25g, 2.5g, 10g.
4-methoxy-3-methylbenzenesulfonyl chloride (CAS 84910-98-5) is a chemical compound with the molecular formula C8H9ClO3S and a molecular weight of 220.67 g/mol. IUPAC name: 4-methoxy-3-methylbenzenesulfonyl chloride. InChIKey: JJDPJUVEBAXEDF-UHFFFAOYSA-N.
| Molecular formula | C8H9ClO3S |
|---|---|
| Molecular weight | 220.67 g/mol |
| IUPAC name | 4-methoxy-3-methylbenzenesulfonyl chloride |
| InChIKey | JJDPJUVEBAXEDF-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)S(=O)(=O)Cl)OC |
Computed by PubChem (NCBI)