CAS 144235-64-3 is the registry number for 4-((1H-1,2,4-Triazol-1-yl)methyl)aniline hydrochloride, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(1,2,4-triazol-1-ylmethyl)aniline;hydrochloride (CAS 144235-64-3) is a chemical compound with the molecular formula C9H11ClN4 and a molecular weight of 210.66 g/mol. IUPAC name: 4-(1,2,4-triazol-1-ylmethyl)aniline;hydrochloride. InChIKey: FEDYLAMMQSHIOY-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN4 |
|---|---|
| Molecular weight | 210.66 g/mol |
| IUPAC name | 4-(1,2,4-triazol-1-ylmethyl)aniline;hydrochloride |
| InChIKey | FEDYLAMMQSHIOY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN2C=NC=N2)N.Cl |
Computed by PubChem (NCBI)