Products 1107694-81-4
CAS 1107694-81-4 is the registry number for 2-Chloro-7-nitro-quinazolin-4-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
2-chloro-7-nitroquinazolin-4-amine (CAS 1107694-81-4) is a chemical compound with the molecular formula C8H5ClN4O2 and a molecular weight of 224.60 g/mol. IUPAC name: 2-chloro-7-nitroquinazolin-4-amine. InChIKey: OJTHHPQACVQRRT-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN4O2 |
|---|---|
| Molecular weight | 224.60 g/mol |
| IUPAC name | 2-chloro-7-nitroquinazolin-4-amine |
| InChIKey | OJTHHPQACVQRRT-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])N=C(N=C2N)Cl |
Computed by PubChem (NCBI)