Products 309720-72-7

CAS 309720-72-7 is the registry number for 2-Chloro-4-(1H-1,2,3,4-tetrazol-1-yl)benzoic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

2-chloro-4-(tetrazol-1-yl)benzoic acid (CAS 309720-72-7) is a chemical compound with the molecular formula C8H5ClN4O2 and a molecular weight of 224.60 g/mol. IUPAC name: 2-chloro-4-(tetrazol-1-yl)benzoic acid. InChIKey: CYYPBOXVGUOKCD-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5ClN4O2
Molecular weight224.60 g/mol
IUPAC name2-chloro-4-(tetrazol-1-yl)benzoic acid
InChIKeyCYYPBOXVGUOKCD-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1N2C=NN=N2)Cl)C(=O)O

Computed by PubChem (NCBI)