CAS 309720-72-7 is the registry number for 2-Chloro-4-(1H-1,2,3,4-tetrazol-1-yl)benzoic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
2-chloro-4-(tetrazol-1-yl)benzoic acid (CAS 309720-72-7) is a chemical compound with the molecular formula C8H5ClN4O2 and a molecular weight of 224.60 g/mol. IUPAC name: 2-chloro-4-(tetrazol-1-yl)benzoic acid. InChIKey: CYYPBOXVGUOKCD-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN4O2 |
|---|---|
| Molecular weight | 224.60 g/mol |
| IUPAC name | 2-chloro-4-(tetrazol-1-yl)benzoic acid |
| InChIKey | CYYPBOXVGUOKCD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N2C=NN=N2)Cl)C(=O)O |
Computed by PubChem (NCBI)