CAS 59301-26-7 appears in our catalog under these names: 5-Chloro-3-(3-nitrophenyl)-1H-1,2,4-triazole, 95%, 5-Chloro-3-(3-nitrophenyl)-1H-1,2,4-triazole. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-chloro-3-(3-nitrophenyl)-1H-1,2,4-triazole (CAS 59301-26-7) is a chemical compound with the molecular formula C8H5ClN4O2 and a molecular weight of 224.60 g/mol. IUPAC name: 5-chloro-3-(3-nitrophenyl)-1H-1,2,4-triazole. InChIKey: AFMRRRJQANGAQH-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN4O2 |
|---|---|
| Molecular weight | 224.60 g/mol |
| IUPAC name | 5-chloro-3-(3-nitrophenyl)-1H-1,2,4-triazole |
| InChIKey | AFMRRRJQANGAQH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C2=NNC(=N2)Cl |
Computed by PubChem (NCBI)