Products 1368525-24-9
CAS 1368525-24-9 is the registry number for 2-(2-Chlorophenyl)-2H-tetrazole-5-carboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g.
2-(2-chlorophenyl)tetrazole-5-carboxylic acid (CAS 1368525-24-9) is a chemical compound with the molecular formula C8H5ClN4O2 and a molecular weight of 224.60 g/mol. IUPAC name: 2-(2-chlorophenyl)tetrazole-5-carboxylic acid. InChIKey: OEALLFQYQSFVQA-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN4O2 |
|---|---|
| Molecular weight | 224.60 g/mol |
| IUPAC name | 2-(2-chlorophenyl)tetrazole-5-carboxylic acid |
| InChIKey | OEALLFQYQSFVQA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N2N=C(N=N2)C(=O)O)Cl |
Computed by PubChem (NCBI)