CAS 2640968-14-3 is the registry number for 3-(2-Chloro-4-nitrophenyl)-4H-1,2,4-triazole hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(2-chloro-4-nitrophenyl)-1H-1,2,4-triazole (CAS 2640968-14-3) is a chemical compound with the molecular formula C8H5ClN4O2 and a molecular weight of 224.60 g/mol. IUPAC name: 5-(2-chloro-4-nitrophenyl)-1H-1,2,4-triazole. InChIKey: LLMDETXWULAHHL-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN4O2 |
|---|---|
| Molecular weight | 224.60 g/mol |
| IUPAC name | 5-(2-chloro-4-nitrophenyl)-1H-1,2,4-triazole |
| InChIKey | LLMDETXWULAHHL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])Cl)C2=NC=NN2 |
Computed by PubChem (NCBI)