CAS 449758-26-3 appears in our catalog under these names: 5-Chloro-2-(1H-tetrazol-1-yl)benzoic acid, 5-Chloro-2-(tetrazol-1-yl)benzoic acid. Offered by: Biosynth, HPC Standards. Available pack sizes: 100mg, 1g, 1x250mg.
5-chloro-2-(tetrazol-1-yl)benzoic acid (CAS 449758-26-3) is a chemical compound with the molecular formula C8H5ClN4O2 and a molecular weight of 224.60 g/mol. IUPAC name: 5-chloro-2-(tetrazol-1-yl)benzoic acid. InChIKey: OSXJGDGNJRHIKP-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN4O2 |
|---|---|
| Molecular weight | 224.60 g/mol |
| IUPAC name | 5-chloro-2-(tetrazol-1-yl)benzoic acid |
| InChIKey | OSXJGDGNJRHIKP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(=O)O)N2C=NN=N2 |
Computed by PubChem (NCBI)